C25H20FNO6 — CID 41102914
methyl 4-[(2S)-3-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 41102914) has the molecular formula C25H20FNO6 and a molecular weight of 449.43 g/mol. Its IUPAC name is methyl 4-[(2S)-3-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S)-3-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 41102914 |
| Molecular Formula | C25H20FNO6 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | methyl 4-[(2S)-3-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C(=C(O)c3ccc(C)c(F)c3)C(=O)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C25H20FNO6/c1-14-5-6-17(12-19(14)26)22(28)20-21(15-7-9-16(10-8-15)25(31)32-2)27(24(30)23(20)29)13-18-4-3-11-33-18/h3-12,21,28H,13H2,1-2H3/t21-/m0/s1 |
| InChIKey | UGUOEZGTBZMHSB-NRFANRHFSA-N |
| XLogP | 4.14 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|