C26H23NO8 — CID 27305863
methyl 4-[(2R)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 27305863) has the molecular formula C26H23NO8 and a molecular weight of 477.47 g/mol. Its IUPAC name is methyl 4-[(2R)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 27305863 |
| Molecular Formula | C26H23NO8 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | methyl 4-[(2R)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C(=C(O)c3ccc(OC)c(OC)c3)C(=O)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C26H23NO8/c1-32-19-11-10-17(13-20(19)33-2)23(28)21-22(15-6-8-16(9-7-15)26(31)34-3)27(25(30)24(21)29)14-18-5-4-12-35-18/h4-13,22,28H,14H2,1-3H3/t22-/m1/s1 |
| InChIKey | DYWJROZCGUQFGY-JOCHJYFZSA-N |
| XLogP | 3.71 |
| TPSA | 115.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|