C27H25NO7 — CID 75095289
4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 75095289) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 75095289 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(C2C(=C(O)c3ccc(OC)c(OC)c3)C(=O)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C27H25NO7/c1-4-13-34-19-10-7-17(8-11-19)24-23(25(29)18-9-12-21(32-2)22(15-18)33-3)26(30)27(31)28(24)16-20-6-5-14-35-20/h4-12,14-15,24,29H,1,13,16H2,2-3H3 |
| InChIKey | UUDNFNRYORREEF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|