C32H29NO7 — CID 98348675
(4E,5S)-5-(3,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione (PubChem CID 98348675) has the molecular formula C32H29NO7 and a molecular weight of 539.58 g/mol. Its IUPAC name is (4E,5S)-5-(3,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(3,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98348675 |
| Molecular Formula | C32H29NO7 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | (4E,5S)-5-(3,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc([C@H]2/C(=C(\O)c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2Cc2ccco2)cc1OC |
| InChI | InChI=1S/C32H29NO7/c1-20-7-4-5-8-23(20)19-40-24-13-10-21(11-14-24)30(34)28-29(22-12-15-26(37-2)27(17-22)38-3)33(32(36)31(28)35)18-25-9-6-16-39-25/h4-17,29,34H,18-19H2,1-3H3/b30-28+/t29-/m0/s1 |
| InChIKey | DIFPUCVAUUVULO-MIOXIQPJSA-N |
| XLogP | 5.81 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|