C35H35NO7 — CID 6191851
(4E)-5-(4-butoxy-3-methoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione (PubChem CID 6191851) has the molecular formula C35H35NO7 and a molecular weight of 581.67 g/mol. Its IUPAC name is (4E)-5-(4-butoxy-3-methoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-butoxy-3-methoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6191851 |
| Molecular Formula | C35H35NO7 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | (4E)-5-(4-butoxy-3-methoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc(C2/C(=C(\O)c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2Cc2ccco2)cc1OC |
| InChI | InChI=1S/C35H35NO7/c1-4-5-18-42-29-17-14-25(20-30(29)40-3)32-31(34(38)35(39)36(32)21-28-11-8-19-41-28)33(37)24-12-15-27(16-13-24)43-22-26-10-7-6-9-23(26)2/h6-17,19-20,32,37H,4-5,18,21-22H2,1-3H3/b33-31+ |
| InChIKey | AABIWAZCISMWMD-QOSDPKFLSA-N |
| XLogP | 6.98 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|