C29H31NO7 — CID 5187906
5-(4-butoxy-3-ethoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 5187906) has the molecular formula C29H31NO7 and a molecular weight of 505.57 g/mol. Its IUPAC name is 5-(4-butoxy-3-ethoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 5-(4-butoxy-3-ethoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5187906 |
| Molecular Formula | C29H31NO7 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 5-(4-butoxy-3-ethoxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc(C2C(=C(O)c3ccc(OC)cc3)C(=O)C(=O)N2Cc2ccco2)cc1OCC |
| InChI | InChI=1S/C29H31NO7/c1-4-6-15-37-23-14-11-20(17-24(23)35-5-2)26-25(27(31)19-9-12-21(34-3)13-10-19)28(32)29(33)30(26)18-22-8-7-16-36-22/h7-14,16-17,26,31H,4-6,15,18H2,1-3H3 |
| InChIKey | HSFXBGLXQWNZBR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|