C27H26BrNO6 — CID 7829242
(5R)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-butoxy-3-methoxyphenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 7829242) has the molecular formula C27H26BrNO6 and a molecular weight of 540.41 g/mol. Its IUPAC name is (5R)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-butoxy-3-methoxyphenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-butoxy-3-methoxyphenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 7829242 |
| Molecular Formula | C27H26BrNO6 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | (5R)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-butoxy-3-methoxyphenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc([C@@H]2C(=C(O)c3ccc(Br)cc3)C(=O)C(=O)N2Cc2ccco2)cc1OC |
| InChI | InChI=1S/C27H26BrNO6/c1-3-4-13-35-21-12-9-18(15-22(21)33-2)24-23(25(30)17-7-10-19(28)11-8-17)26(31)27(32)29(24)16-20-6-5-14-34-20/h5-12,14-15,24,30H,3-4,13,16H2,1-2H3/t24-/m1/s1 |
| InChIKey | VDJBKEJWYZWZFB-XMMPIXPASA-N |
| XLogP | 5.85 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|