C37H44N2O7 — CID 4698905
4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione (PubChem CID 4698905) has the molecular formula C37H44N2O7 and a molecular weight of 628.77 g/mol. Its IUPAC name is 4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4698905 |
| Molecular Formula | C37H44N2O7 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | 4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(C2C(=C(O)c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2CCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C37H44N2O7/c1-4-5-8-21-45-31-16-13-28(24-32(31)43-3)34-33(36(41)37(42)39(34)18-17-38-19-22-44-23-20-38)35(40)27-11-14-30(15-12-27)46-25-29-10-7-6-9-26(29)2/h6-7,9-16,24,34,40H,4-5,8,17-23,25H2,1-3H3 |
| InChIKey | HLXOHUDUDFZHLE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|