C25H33N3O4 — CID 41106127
2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide (PubChem CID 41106127) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide.
| Compound Name | 2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 41106127 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide |
| SMILES | C[C@H]1C[C@H](NC(=O)C(=O)c2cn(CC(=O)N3CCOCC3)c3ccccc23)CC(C)(C)C1 |
| InChI | InChI=1S/C25H33N3O4/c1-17-12-18(14-25(2,3)13-17)26-24(31)23(30)20-15-28(21-7-5-4-6-19(20)21)16-22(29)27-8-10-32-11-9-27/h4-7,15,17-18H,8-14,16H2,1-3H3,(H,26,31)/t17-,18-/m0/s1 |
| InChIKey | HCAKLDIVAZLYMA-ROUUACIJSA-N |
| XLogP | 3.01 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|