C25H40N4O3 — CID 41118319
N-tert-butyl-2-[4-[2-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]acetyl]piperazin-1-yl]acetamide (PubChem CID 41118319) has the molecular formula C25H40N4O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[2-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[2-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 41118319 |
| Molecular Formula | C25H40N4O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | N-tert-butyl-2-[4-[2-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]acetyl]piperazin-1-yl]acetamide |
| SMILES | COc1ccc([C@H]2CCCCCN2CC(=O)N2CCN(CC(=O)NC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H40N4O3/c1-25(2,3)26-23(30)18-27-14-16-28(17-15-27)24(31)19-29-13-7-5-6-8-22(29)20-9-11-21(32-4)12-10-20/h9-12,22H,5-8,13-19H2,1-4H3,(H,26,30)/t22-/m1/s1 |
| InChIKey | FNGZRGLXURCRQV-JOCHJYFZSA-N |
| XLogP | 2.67 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |