C26H31N5OS — CID 41119724
1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-(3,4-dimethylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 41119724) has the molecular formula C26H31N5OS and a molecular weight of 461.64 g/mol. Its IUPAC name is 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-(3,4-dimethylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-(3,4-dimethylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 41119724 |
| Molecular Formula | C26H31N5OS |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-(3,4-dimethylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | Cc1ccc(-n2c(SCC(=O)N3CCC[C@H]4CCCC[C@@H]43)nnc2-c2ccncc2)cc1C |
| InChI | InChI=1S/C26H31N5OS/c1-18-9-10-22(16-19(18)2)31-25(21-11-13-27-14-12-21)28-29-26(31)33-17-24(32)30-15-5-7-20-6-3-4-8-23(20)30/h9-14,16,20,23H,3-8,15,17H2,1-2H3/t20-,23+/m1/s1 |
| InChIKey | GFDYVLPWSAUZKC-OFNKIYASSA-N |
| XLogP | 5.22 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |