C25H29N5OS — CID 41367970
1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 41367970) has the molecular formula C25H29N5OS and a molecular weight of 447.61 g/mol. Its IUPAC name is 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 41367970 |
| Molecular Formula | C25H29N5OS |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | O=C(CSc1nnc(-c2ccncc2)n1Cc1ccccc1)N1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C25H29N5OS/c31-23(29-16-6-10-20-9-4-5-11-22(20)29)18-32-25-28-27-24(21-12-14-26-15-13-21)30(25)17-19-7-2-1-3-8-19/h1-3,7-8,12-15,20,22H,4-6,9-11,16-18H2/t20-,22-/m0/s1 |
| InChIKey | SFZMVWHONSOLBC-UNMCSNQZSA-N |
| XLogP | 4.66 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |