C23H26N4O3S — CID 55803267
1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 55803267) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 55803267 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | O=C(CSc1nnc(-c2ccco2)n1Cc1ccccc1)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C23H26N4O3S/c28-21(26-12-14-30-19-10-5-4-9-18(19)26)16-31-23-25-24-22(20-11-6-13-29-20)27(23)15-17-7-2-1-3-8-17/h1-3,6-8,11,13,18-19H,4-5,9-10,12,14-16H2 |
| InChIKey | SKGNOUVVMAUANR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |