C19H13ClFN3OS — CID 4112613
3-chloro-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-benzothiophene-2-carboxamide (PubChem CID 4112613) has the molecular formula C19H13ClFN3OS and a molecular weight of 385.85 g/mol. Its IUPAC name is 3-chloro-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4112613 |
| Molecular Formula | C19H13ClFN3OS |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 3-chloro-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccc(F)cc2)c1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C19H13ClFN3OS/c20-17-15-3-1-2-4-16(15)26-18(17)19(25)23-14-9-22-24(11-14)10-12-5-7-13(21)8-6-12/h1-9,11H,10H2,(H,23,25) |
| InChIKey | UGDNVKAQKDCZQY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |