C22H26N6O4S — CID 41127294
2-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 41127294) has the molecular formula C22H26N6O4S and a molecular weight of 470.56 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 41127294 |
| Molecular Formula | C22H26N6O4S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | CC(C)Cn1c(SCC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)nnc1-c1ccco1 |
| InChI | InChI=1S/C22H26N6O4S/c1-16(2)14-27-21(19-4-3-13-32-19)23-24-22(27)33-15-20(29)26-11-9-25(10-12-26)17-5-7-18(8-6-17)28(30)31/h3-8,13,16H,9-12,14-15H2,1-2H3 |
| InChIKey | UDFLXGWVHMOLGA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 110.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|