C21H18N4O2 — CID 41130841
(3S)-3'-[(3-methylquinoxalin-2-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 41130841) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is (3S)-3'-[(3-methylquinoxalin-2-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3S)-3'-[(3-methylquinoxalin-2-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 41130841 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (3S)-3'-[(3-methylquinoxalin-2-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1nc2ccccc2nc1CN1C(=O)N[C@]2(CCc3ccccc32)C1=O |
| InChI | InChI=1S/C21H18N4O2/c1-13-18(23-17-9-5-4-8-16(17)22-13)12-25-19(26)21(24-20(25)27)11-10-14-6-2-3-7-15(14)21/h2-9H,10-12H2,1H3,(H,24,27)/t21-/m0/s1 |
| InChIKey | FHKPDYUTKAXGNI-NRFANRHFSA-N |
| XLogP | 2.83 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|