C20H24N4O2S2 — CID 41131231
N-cyclopropyl-N-[5-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 41131231) has the molecular formula C20H24N4O2S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-cyclopropyl-N-[5-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 41131231 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-cyclopropyl-N-[5-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)N(c1nnc(S[C@@H](C(=O)N2CCCC2)c2ccccc2)s1)C1CC1 |
| InChI | InChI=1S/C20H24N4O2S2/c1-2-16(25)24(15-10-11-15)19-21-22-20(28-19)27-17(14-8-4-3-5-9-14)18(26)23-12-6-7-13-23/h3-5,8-9,15,17H,2,6-7,10-13H2,1H3/t17-/m1/s1 |
| InChIKey | YXIYWGZZOYMKJB-QGZVFWFLSA-N |
| XLogP | 3.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|