C21H20N4O6 — CID 41133469
2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)acetamide (PubChem CID 41133469) has the molecular formula C21H20N4O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)acetamide.
| Compound Name | 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 41133469 |
| Molecular Formula | C21H20N4O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)acetamide |
| SMILES | O=C(CN1C(=O)N[C@H](Cc2ccccc2)C1=O)NC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H20N4O6/c26-18(24-20(28)22-14-6-7-16-17(11-14)31-9-8-30-16)12-25-19(27)15(23-21(25)29)10-13-4-2-1-3-5-13/h1-7,11,15H,8-10,12H2,(H,23,29)(H2,22,24,26,28)/t15-/m1/s1 |
| InChIKey | LGQCWFVWUKGAPE-OAHLLOKOSA-N |
| XLogP | 1.27 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|