C26H24N2O4 — CID 41134830
2-[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethoxy]-N-benzylbenzamide (PubChem CID 41134830) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethoxy]-N-benzylbenzamide.
| Compound Name | 2-[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethoxy]-N-benzylbenzamide |
|---|---|
| PubChem CID | 41134830 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethoxy]-N-benzylbenzamide |
| SMILES | C[C@H](NC(=O)COc1ccccc1C(=O)NCc1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C26H24N2O4/c1-18(24-15-20-11-5-7-13-22(20)32-24)28-25(29)17-31-23-14-8-6-12-21(23)26(30)27-16-19-9-3-2-4-10-19/h2-15,18H,16-17H2,1H3,(H,27,30)(H,28,29)/t18-/m0/s1 |
| InChIKey | UKQQYTWPNIFPQP-SFHVURJKSA-N |
| XLogP | 4.62 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |