C19H26N4O5S3 — CID 41138225
1-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 41138225) has the molecular formula C19H26N4O5S3 and a molecular weight of 486.64 g/mol. Its IUPAC name is 1-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 41138225 |
| Molecular Formula | C19H26N4O5S3 |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 1-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | Cc1cc(C(=O)CSc2nnc([C@H]3CCS(=O)(=O)C3)n2C)c(C)n1[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H26N4O5S3/c1-12-8-16(13(2)23(12)15-5-7-31(27,28)11-15)17(24)9-29-19-21-20-18(22(19)3)14-4-6-30(25,26)10-14/h8,14-15H,4-7,9-11H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | WUKWMTYMUOPJIE-GJZGRUSLSA-N |
| XLogP | 1.47 |
| TPSA | 120.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |