C19H23N5O3S2 — CID 46435803
2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)sulfanyl]-1-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 46435803) has the molecular formula C19H23N5O3S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)sulfanyl]-1-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)sulfanyl]-1-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 46435803 |
| Molecular Formula | C19H23N5O3S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)sulfanyl]-1-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | Cc1cc2nnc(SCC(=O)c3cc(C)n(C4CCS(=O)(=O)C4)c3C)n2c(C)n1 |
| InChI | InChI=1S/C19H23N5O3S2/c1-11-7-18-21-22-19(24(18)14(4)20-11)28-9-17(25)16-8-12(2)23(13(16)3)15-5-6-29(26,27)10-15/h7-8,15H,5-6,9-10H2,1-4H3 |
| InChIKey | DLAVUNZRCRGDPF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |