C25H29N3O3S2 — CID 25370839
1-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-[(1-phenyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)sulfanyl]ethanone (PubChem CID 25370839) has the molecular formula C25H29N3O3S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 1-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-[(1-phenyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)sulfanyl]ethanone.
| Compound Name | 1-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-[(1-phenyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 25370839 |
| Molecular Formula | C25H29N3O3S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 1-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-[(1-phenyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)sulfanyl]ethanone |
| SMILES | Cc1cc(C(=O)CSc2nc3c(n2-c2ccccc2)CCCC3)c(C)n1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H29N3O3S2/c1-17-14-21(18(2)27(17)20-12-13-33(30,31)16-20)24(29)15-32-25-26-22-10-6-7-11-23(22)28(25)19-8-4-3-5-9-19/h3-5,8-9,14,20H,6-7,10-13,15-16H2,1-2H3/t20-/m1/s1 |
| InChIKey | UENJMZOESZIATQ-HXUWFJFHSA-N |
| XLogP | 4.50 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |