C32H40N2O — CID 41141174
2,6-ditert-butyl-4-[(S)-[4-(dimethylamino)phenyl]-(2-methyl-1H-indol-3-yl)methyl]phenol (PubChem CID 41141174) has the molecular formula C32H40N2O and a molecular weight of 468.69 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(S)-[4-(dimethylamino)phenyl]-(2-methyl-1H-indol-3-yl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(S)-[4-(dimethylamino)phenyl]-(2-methyl-1H-indol-3-yl)methyl]phenol |
|---|---|
| PubChem CID | 41141174 |
| Molecular Formula | C32H40N2O |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 2,6-ditert-butyl-4-[(S)-[4-(dimethylamino)phenyl]-(2-methyl-1H-indol-3-yl)methyl]phenol |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H](c1ccc(N(C)C)cc1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H40N2O/c1-20-28(24-12-10-11-13-27(24)33-20)29(21-14-16-23(17-15-21)34(8)9)22-18-25(31(2,3)4)30(35)26(19-22)32(5,6)7/h10-19,29,33,35H,1-9H3/t29-/m0/s1 |
| InChIKey | RZGFIQUDMYCAKL-LJAQVGFWSA-N |
| XLogP | 8.02 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|