C14H17ClN2OS2 — CID 41141327
(5S)-3-[(1R)-1-(3-chlorophenyl)ethyl]-5-(2-methylsulfanylethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 41141327) has the molecular formula C14H17ClN2OS2 and a molecular weight of 328.89 g/mol. Its IUPAC name is (5S)-3-[(1R)-1-(3-chlorophenyl)ethyl]-5-(2-methylsulfanylethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5S)-3-[(1R)-1-(3-chlorophenyl)ethyl]-5-(2-methylsulfanylethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 41141327 |
| Molecular Formula | C14H17ClN2OS2 |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | (5S)-3-[(1R)-1-(3-chlorophenyl)ethyl]-5-(2-methylsulfanylethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CSCC[C@@H]1NC(=S)N([C@H](C)c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C14H17ClN2OS2/c1-9(10-4-3-5-11(15)8-10)17-13(18)12(6-7-20-2)16-14(17)19/h3-5,8-9,12H,6-7H2,1-2H3,(H,16,19)/t9-,12+/m1/s1 |
| InChIKey | DXMRUPVQBUWLFI-SKDRFNHKSA-N |
| XLogP | 3.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|