C22H23ClN4O2 — CID 41143362
1-[(S)-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-phenylmethyl]-3-cyclohexylurea (PubChem CID 41143362) has the molecular formula C22H23ClN4O2 and a molecular weight of 410.91 g/mol. Its IUPAC name is 1-[(S)-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-phenylmethyl]-3-cyclohexylurea.
| Compound Name | 1-[(S)-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-phenylmethyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 41143362 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-[(S)-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-phenylmethyl]-3-cyclohexylurea |
| SMILES | O=C(NC1CCCCC1)N[C@@H](c1ccccc1)c1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C22H23ClN4O2/c23-18-14-8-7-13-17(18)20-26-27-21(29-20)19(15-9-3-1-4-10-15)25-22(28)24-16-11-5-2-6-12-16/h1,3-4,7-10,13-14,16,19H,2,5-6,11-12H2,(H2,24,25,28)/t19-/m0/s1 |
| InChIKey | ISBMNIMZUILTFL-IBGZPJMESA-N |
| XLogP | 5.11 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |