C24H27N3O5S — CID 41149330
4-[cyclohexyl(ethyl)sulfamoyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide (PubChem CID 41149330) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is 4-[cyclohexyl(ethyl)sulfamoyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide.
| Compound Name | 4-[cyclohexyl(ethyl)sulfamoyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide |
|---|---|
| PubChem CID | 41149330 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 4-[cyclohexyl(ethyl)sulfamoyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide |
| SMILES | CCN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)cc1 |
| InChI | InChI=1S/C24H27N3O5S/c1-3-27(18-7-5-4-6-8-18)33(31,32)19-12-9-16(10-13-19)22(28)25-17-11-14-20-21(15-17)24(30)26(2)23(20)29/h9-15,18H,3-8H2,1-2H3,(H,25,28) |
| InChIKey | UIMYNFWGUQMCLU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|