C20H19N3O5S — CID 41363949
4-[cyclopropyl(methyl)sulfamoyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide (PubChem CID 41363949) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 4-[cyclopropyl(methyl)sulfamoyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide.
| Compound Name | 4-[cyclopropyl(methyl)sulfamoyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide |
|---|---|
| PubChem CID | 41363949 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-[cyclopropyl(methyl)sulfamoyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3ccc(S(=O)(=O)N(C)C4CC4)cc3)cc2C1=O |
| InChI | InChI=1S/C20H19N3O5S/c1-22-19(25)16-10-5-13(11-17(16)20(22)26)21-18(24)12-3-8-15(9-4-12)29(27,28)23(2)14-6-7-14/h3-5,8-11,14H,6-7H2,1-2H3,(H,21,24) |
| InChIKey | QSSIKOCRWKZDSV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|