C19H22N4O4S2 — CID 41153080
N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-methoxy-5-sulfamoylbenzamide (PubChem CID 41153080) has the molecular formula C19H22N4O4S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-methoxy-5-sulfamoylbenzamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-methoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 41153080 |
| Molecular Formula | C19H22N4O4S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-methoxy-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)N[C@@H](CCSC)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H22N4O4S2/c1-27-17-8-7-12(29(20,25)26)11-13(17)19(24)23-16(9-10-28-2)18-21-14-5-3-4-6-15(14)22-18/h3-8,11,16H,9-10H2,1-2H3,(H,21,22)(H,23,24)(H2,20,25,26)/t16-/m0/s1 |
| InChIKey | NLSLYVSIWCQSOK-INIZCTEOSA-N |
| XLogP | 2.44 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |