C19H19N3O3S — CID 41155193
(2S)-2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-phenylpropanamide (PubChem CID 41155193) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is (2S)-2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-phenylpropanamide.
| Compound Name | (2S)-2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 41155193 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (2S)-2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-phenylpropanamide |
| SMILES | C[C@@H](C(=O)Nc1ccccc1)N1C(=O)N[C@@]2(CCCc3sccc32)C1=O |
| InChI | InChI=1S/C19H19N3O3S/c1-12(16(23)20-13-6-3-2-4-7-13)22-17(24)19(21-18(22)25)10-5-8-15-14(19)9-11-26-15/h2-4,6-7,9,11-12H,5,8,10H2,1H3,(H,20,23)(H,21,25)/t12-,19+/m0/s1 |
| InChIKey | FHEJMTFKRHKDAM-HXPMCKFVSA-N |
| XLogP | 2.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|