C23H26N4O3 — CID 2568044
(2R)-N-[4-(dimethylamino)phenyl]-2-[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]propanamide (PubChem CID 2568044) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is (2R)-N-[4-(dimethylamino)phenyl]-2-[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]propanamide.
| Compound Name | (2R)-N-[4-(dimethylamino)phenyl]-2-[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]propanamide |
|---|---|
| PubChem CID | 2568044 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (2R)-N-[4-(dimethylamino)phenyl]-2-[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(N(C)C)cc1)N1C(=O)N[C@@]2(CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C23H26N4O3/c1-15(20(28)24-17-10-12-18(13-11-17)26(2)3)27-21(29)23(25-22(27)30)14-6-8-16-7-4-5-9-19(16)23/h4-5,7,9-13,15H,6,8,14H2,1-3H3,(H,24,28)(H,25,30)/t15-,23-/m1/s1 |
| InChIKey | YTGOMIVORRQDDB-IQMFZBJNSA-N |
| XLogP | 2.86 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|