C22H22N4O6 — CID 2368211
(2R)-2-[(4S)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 2368211) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is (2R)-2-[(4S)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[(4S)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 2368211 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (2R)-2-[(4S)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)N1C(=O)N[C@]2(CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C22H22N4O6/c1-13(19(27)23-17-12-15(26(30)31)9-10-18(17)32-2)25-20(28)22(24-21(25)29)11-5-7-14-6-3-4-8-16(14)22/h3-4,6,8-10,12-13H,5,7,11H2,1-2H3,(H,23,27)(H,24,29)/t13-,22+/m1/s1 |
| InChIKey | UURCWUNJCOVCKQ-DMZKTXOQSA-N |
| XLogP | 2.71 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|