C27H32N4O5 — CID 41155651
2-[(4R)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide (PubChem CID 41155651) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2-[(4R)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide.
| Compound Name | 2-[(4R)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 41155651 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 2-[(4R)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide |
| SMILES | CC1CCN(c2ccc(NC(=O)CN3C(=O)N[C@](C)(c4ccc5c(c4)OCCCO5)C3=O)cc2)CC1 |
| InChI | InChI=1S/C27H32N4O5/c1-18-10-12-30(13-11-18)21-7-5-20(6-8-21)28-24(32)17-31-25(33)27(2,29-26(31)34)19-4-9-22-23(16-19)36-15-3-14-35-22/h4-9,16,18H,3,10-15,17H2,1-2H3,(H,28,32)(H,29,34)/t27-/m1/s1 |
| InChIKey | XHCKZWZNRDZEOC-HHHXNRCGSA-N |
| XLogP | 3.49 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|