C27H32N4O8S — CID 98384667
2-[(4R)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]acetamide (PubChem CID 98384667) has the molecular formula C27H32N4O8S and a molecular weight of 572.64 g/mol. Its IUPAC name is 2-[(4R)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]acetamide.
| Compound Name | 2-[(4R)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 98384667 |
| Molecular Formula | C27H32N4O8S |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 2-[(4R)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]acetamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(NC(=O)CN3C(=O)N[C@](C)(c4ccc5c(c4)OCCCO5)C3=O)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C27H32N4O8S/c1-17-14-30(15-18(2)39-17)40(35,36)21-8-6-20(7-9-21)28-24(32)16-31-25(33)27(3,29-26(31)34)19-5-10-22-23(13-19)38-12-4-11-37-22/h5-10,13,17-18H,4,11-12,14-16H2,1-3H3,(H,28,32)(H,29,34)/t17-,18+,27-/m1/s1 |
| InChIKey | OOGUZDXXRMUGQB-DLEQGYHRSA-N |
| XLogP | 2.05 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|