C20H25N3O6 — CID 7962421
(5R)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 7962421) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is (5R)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7962421 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (5R)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@H]1CN(C(=O)CN2C(=O)N[C@](C)(c3ccc4c(c3)OCCO4)C2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C20H25N3O6/c1-12-9-22(10-13(2)29-12)17(24)11-23-18(25)20(3,21-19(23)26)14-4-5-15-16(8-14)28-7-6-27-15/h4-5,8,12-13H,6-7,9-11H2,1-3H3,(H,21,26)/t12-,13+,20-/m1/s1 |
| InChIKey | WWGHDUKHRBVRSO-MTJIALIYSA-N |
| XLogP | 0.86 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|