C19H17N5OS2 — CID 41157463
(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone (PubChem CID 41157463) has the molecular formula C19H17N5OS2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone.
| Compound Name | (5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 41157463 |
| Molecular Formula | C19H17N5OS2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | (5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone |
| SMILES | Cc1cc(C)n2nc(C(=O)N3CCc4sccc4[C@@H]3c3cccs3)nc2n1 |
| InChI | InChI=1S/C19H17N5OS2/c1-11-10-12(2)24-19(20-11)21-17(22-24)18(25)23-7-5-14-13(6-9-27-14)16(23)15-4-3-8-26-15/h3-4,6,8-10,16H,5,7H2,1-2H3/t16-/m1/s1 |
| InChIKey | ZFWVFVHNUULHIB-MRXNPFEDSA-N |
| XLogP | 3.65 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |