C25H25N5O3 — CID 41170098
[(1S)-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl]-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone (PubChem CID 41170098) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is [(1S)-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl]-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone.
| Compound Name | [(1S)-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl]-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 41170098 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | [(1S)-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl]-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccccc1)N(C(=O)c1nc3nc(C)cc(C)n3n1)CC2 |
| InChI | InChI=1S/C25H25N5O3/c1-15-12-16(2)30-25(26-15)27-23(28-30)24(31)29-11-10-18-13-20(32-3)21(33-4)14-19(18)22(29)17-8-6-5-7-9-17/h5-9,12-14,22H,10-11H2,1-4H3/t22-/m0/s1 |
| InChIKey | CWBMQETZGOPYRE-QFIPXVFZSA-N |
| XLogP | 3.55 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |