C10H9F3N2O — CID 4116465
3-(3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-ylidene)-1,1,1-trifluoropropan-2-one (PubChem CID 4116465) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-ylidene)-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-(3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-ylidene)-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 4116465 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-(3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-ylidene)-1,1,1-trifluoropropan-2-one |
| SMILES | O=C(C=C1NCCn2cccc21)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O/c11-10(12,13)9(16)6-7-8-2-1-4-15(8)5-3-14-7/h1-2,4,6,14H,3,5H2 |
| InChIKey | WVDWRPOQBKIYEZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|