C22H24BrN3O2 — CID 41165242
(3S)-5-(4-bromophenyl)-N-cyclohexyl-3-(2-hydroxyphenyl)-3,4-dihydropyrazole-2-carboxamide (PubChem CID 41165242) has the molecular formula C22H24BrN3O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is (3S)-5-(4-bromophenyl)-N-cyclohexyl-3-(2-hydroxyphenyl)-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | (3S)-5-(4-bromophenyl)-N-cyclohexyl-3-(2-hydroxyphenyl)-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 41165242 |
| Molecular Formula | C22H24BrN3O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | (3S)-5-(4-bromophenyl)-N-cyclohexyl-3-(2-hydroxyphenyl)-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1N=C(c2ccc(Br)cc2)C[C@H]1c1ccccc1O |
| InChI | InChI=1S/C22H24BrN3O2/c23-16-12-10-15(11-13-16)19-14-20(18-8-4-5-9-21(18)27)26(25-19)22(28)24-17-6-2-1-3-7-17/h4-5,8-13,17,20,27H,1-3,6-7,14H2,(H,24,28)/t20-/m0/s1 |
| InChIKey | ICQICKUAMZBPHQ-FQEVSTJZSA-N |
| XLogP | 5.35 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|