C27H28N4O2 — CID 59463175
3-(2-hydroxyphenyl)-N-(1-phenylcyclohexyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 59463175) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-N-(1-phenylcyclohexyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 3-(2-hydroxyphenyl)-N-(1-phenylcyclohexyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 59463175 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 3-(2-hydroxyphenyl)-N-(1-phenylcyclohexyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(NC1(c2ccccc2)CCCCC1)N1N=C(c2cccnc2)CC1c1ccccc1O |
| InChI | InChI=1S/C27H28N4O2/c32-25-14-6-5-13-22(25)24-18-23(20-10-9-17-28-19-20)30-31(24)26(33)29-27(15-7-2-8-16-27)21-11-3-1-4-12-21/h1,3-6,9-14,17,19,24,32H,2,7-8,15-16,18H2,(H,29,33) |
| InChIKey | PGCKTQYPVKCVHM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|