C23H19N7O2 — CID 59463119
3-(2-hydroxyphenyl)-5-pyridin-3-yl-N-[4-(1,2,4-triazol-1-yl)phenyl]-3,4-dihydropyrazole-2-carboxamide (PubChem CID 59463119) has the molecular formula C23H19N7O2 and a molecular weight of 425.45 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-5-pyridin-3-yl-N-[4-(1,2,4-triazol-1-yl)phenyl]-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 3-(2-hydroxyphenyl)-5-pyridin-3-yl-N-[4-(1,2,4-triazol-1-yl)phenyl]-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 59463119 |
| Molecular Formula | C23H19N7O2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-(2-hydroxyphenyl)-5-pyridin-3-yl-N-[4-(1,2,4-triazol-1-yl)phenyl]-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cncn2)cc1)N1N=C(c2cccnc2)CC1c1ccccc1O |
| InChI | InChI=1S/C23H19N7O2/c31-22-6-2-1-5-19(22)21-12-20(16-4-3-11-24-13-16)28-30(21)23(32)27-17-7-9-18(10-8-17)29-15-25-14-26-29/h1-11,13-15,21,31H,12H2,(H,27,32) |
| InChIKey | WZYQBLBKKDPFRB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|