C29H26N4O4 — CID 68708302
3-(2-hydroxyphenyl)-N-(4-methoxy-3-phenylmethoxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 68708302) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-N-(4-methoxy-3-phenylmethoxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 3-(2-hydroxyphenyl)-N-(4-methoxy-3-phenylmethoxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 68708302 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 3-(2-hydroxyphenyl)-N-(4-methoxy-3-phenylmethoxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | COc1ccc(NC(=O)N2N=C(c3cccnc3)CC2c2ccccc2O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C29H26N4O4/c1-36-27-14-13-22(16-28(27)37-19-20-8-3-2-4-9-20)31-29(35)33-25(23-11-5-6-12-26(23)34)17-24(32-33)21-10-7-15-30-18-21/h2-16,18,25,34H,17,19H2,1H3,(H,31,35) |
| InChIKey | RKTQTTSZPIGJGI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|