C28H22N4O3 — CID 59463211
N-(3-benzoylphenyl)-3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 59463211) has the molecular formula C28H22N4O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is N-(3-benzoylphenyl)-3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | N-(3-benzoylphenyl)-3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 59463211 |
| Molecular Formula | C28H22N4O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-(3-benzoylphenyl)-3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(c1ccccc1)c1cccc(NC(=O)N2N=C(c3cccnc3)CC2c2ccccc2O)c1 |
| InChI | InChI=1S/C28H22N4O3/c33-26-14-5-4-13-23(26)25-17-24(21-11-7-15-29-18-21)31-32(25)28(35)30-22-12-6-10-20(16-22)27(34)19-8-2-1-3-9-19/h1-16,18,25,33H,17H2,(H,30,35) |
| InChIKey | GRBDYGFAJOVDAS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|