C24H20N6O3S — CID 68704102
3-(2-hydroxyphenyl)-N-[4-(4-methoxyphenyl)thiadiazol-5-yl]-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 68704102) has the molecular formula C24H20N6O3S and a molecular weight of 472.53 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-N-[4-(4-methoxyphenyl)thiadiazol-5-yl]-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 3-(2-hydroxyphenyl)-N-[4-(4-methoxyphenyl)thiadiazol-5-yl]-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 68704102 |
| Molecular Formula | C24H20N6O3S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 3-(2-hydroxyphenyl)-N-[4-(4-methoxyphenyl)thiadiazol-5-yl]-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | COc1ccc(-c2nnsc2NC(=O)N2N=C(c3cccnc3)CC2c2ccccc2O)cc1 |
| InChI | InChI=1S/C24H20N6O3S/c1-33-17-10-8-15(9-11-17)22-23(34-29-27-22)26-24(32)30-20(18-6-2-3-7-21(18)31)13-19(28-30)16-5-4-12-25-14-16/h2-12,14,20,31H,13H2,1H3,(H,26,32) |
| InChIKey | ZSBCEUCWOOYXTO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 112.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|