C27H27N3O3 — CID 59463320
[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-[1-(4-methoxyphenyl)cyclopentyl]methanone (PubChem CID 59463320) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-[1-(4-methoxyphenyl)cyclopentyl]methanone.
| Compound Name | [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-[1-(4-methoxyphenyl)cyclopentyl]methanone |
|---|---|
| PubChem CID | 59463320 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-[1-(4-methoxyphenyl)cyclopentyl]methanone |
| SMILES | COc1ccc(C2(C(=O)N3N=C(c4cccnc4)CC3c3ccccc3O)CCCC2)cc1 |
| InChI | InChI=1S/C27H27N3O3/c1-33-21-12-10-20(11-13-21)27(14-4-5-15-27)26(32)30-24(22-8-2-3-9-25(22)31)17-23(29-30)19-7-6-16-28-18-19/h2-3,6-13,16,18,24,31H,4-5,14-15,17H2,1H3 |
| InChIKey | RXZDZJVZEQURCO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|