C17H13NOS — CID 4116721
6-ethoxy-[1]benzothiolo[2,3-c]quinoline (PubChem CID 4116721) has the molecular formula C17H13NOS and a molecular weight of 279.36 g/mol. Its IUPAC name is 6-ethoxy-[1]benzothiolo[2,3-c]quinoline.
| Compound Name | 6-ethoxy-[1]benzothiolo[2,3-c]quinoline |
|---|---|
| PubChem CID | 4116721 |
| Molecular Formula | C17H13NOS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 6-ethoxy-[1]benzothiolo[2,3-c]quinoline |
| SMILES | CCOc1nc2ccccc2c2c1sc1ccccc12 |
| InChI | InChI=1S/C17H13NOS/c1-2-19-17-16-15(11-7-3-5-9-13(11)18-17)12-8-4-6-10-14(12)20-16/h3-10H,2H2,1H3 |
| InChIKey | GHISCAITJXVFDQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |