C20H17ClFN5O3 — CID 41171315
2-[(3aS,6aS)-5-(3-chloro-4-fluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 41171315) has the molecular formula C20H17ClFN5O3 and a molecular weight of 429.84 g/mol. Its IUPAC name is 2-[(3aS,6aS)-5-(3-chloro-4-fluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[(3aS,6aS)-5-(3-chloro-4-fluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 41171315 |
| Molecular Formula | C20H17ClFN5O3 |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-[(3aS,6aS)-5-(3-chloro-4-fluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CN2N=N[C@@H]3C(=O)N(c4ccc(F)c(Cl)c4)C(=O)[C@H]32)c1 |
| InChI | InChI=1S/C20H17ClFN5O3/c1-10-3-4-11(2)15(7-10)23-16(28)9-26-18-17(24-25-26)19(29)27(20(18)30)12-5-6-14(22)13(21)8-12/h3-8,17-18H,9H2,1-2H3,(H,23,28)/t17-,18-/m0/s1 |
| InChIKey | KKRBFDSAVBOGQW-ROUUACIJSA-N |
| XLogP | 3.03 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|