C24H25N3O3S — CID 41177153
(8R)-8-(3,4-dimethoxyphenyl)-3-(2-ethylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 41177153) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is (8R)-8-(3,4-dimethoxyphenyl)-3-(2-ethylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | (8R)-8-(3,4-dimethoxyphenyl)-3-(2-ethylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 41177153 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (8R)-8-(3,4-dimethoxyphenyl)-3-(2-ethylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | CCc1ccccc1N1CSC2=C(C#N)[C@@H](c3ccc(OC)c(OC)c3)CC(=O)N2C1 |
| InChI | InChI=1S/C24H25N3O3S/c1-4-16-7-5-6-8-20(16)26-14-27-23(28)12-18(19(13-25)24(27)31-15-26)17-9-10-21(29-2)22(11-17)30-3/h5-11,18H,4,12,14-15H2,1-3H3/t18-/m1/s1 |
| InChIKey | QILHELKUSRINCO-GOSISDBHSA-N |
| XLogP | 4.49 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |