C30H29N3O3S — CID 42486187
(8S)-3-(3,4-dimethylphenyl)-8-(3-methoxy-4-phenylmethoxyphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 42486187) has the molecular formula C30H29N3O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is (8S)-3-(3,4-dimethylphenyl)-8-(3-methoxy-4-phenylmethoxyphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | (8S)-3-(3,4-dimethylphenyl)-8-(3-methoxy-4-phenylmethoxyphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 42486187 |
| Molecular Formula | C30H29N3O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | (8S)-3-(3,4-dimethylphenyl)-8-(3-methoxy-4-phenylmethoxyphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | COc1cc([C@@H]2CC(=O)N3CN(c4ccc(C)c(C)c4)CSC3=C2C#N)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H29N3O3S/c1-20-9-11-24(13-21(20)2)32-18-33-29(34)15-25(26(16-31)30(33)37-19-32)23-10-12-27(28(14-23)35-3)36-17-22-7-5-4-6-8-22/h4-14,25H,15,17-19H2,1-3H3/t25-/m0/s1 |
| InChIKey | OQPCOXMGSBQKBQ-VWLOTQADSA-N |
| XLogP | 6.11 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|