C24H25N3OS — CID 20857733
3-(3,4-dimethylphenyl)-8-(4-ethylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 20857733) has the molecular formula C24H25N3OS and a molecular weight of 403.55 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-8-(4-ethylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | 3-(3,4-dimethylphenyl)-8-(4-ethylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 20857733 |
| Molecular Formula | C24H25N3OS |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-8-(4-ethylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | CCc1ccc(C2CC(=O)N3CN(c4ccc(C)c(C)c4)CSC3=C2C#N)cc1 |
| InChI | InChI=1S/C24H25N3OS/c1-4-18-6-8-19(9-7-18)21-12-23(28)27-14-26(15-29-24(27)22(21)13-25)20-10-5-16(2)17(3)11-20/h5-11,21H,4,12,14-15H2,1-3H3 |
| InChIKey | WVCPPNKMMOURLN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|