C21H17BrClN3OS — CID 20857944
8-(4-bromophenyl)-3-(3-chloro-4-methylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 20857944) has the molecular formula C21H17BrClN3OS and a molecular weight of 474.81 g/mol. Its IUPAC name is 8-(4-bromophenyl)-3-(3-chloro-4-methylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | 8-(4-bromophenyl)-3-(3-chloro-4-methylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 20857944 |
| Molecular Formula | C21H17BrClN3OS |
| Molecular Weight | 474.81 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 8-(4-bromophenyl)-3-(3-chloro-4-methylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | Cc1ccc(N2CSC3=C(C#N)C(c4ccc(Br)cc4)CC(=O)N3C2)cc1Cl |
| InChI | InChI=1S/C21H17BrClN3OS/c1-13-2-7-16(8-19(13)23)25-11-26-20(27)9-17(14-3-5-15(22)6-4-14)18(10-24)21(26)28-12-25/h2-8,17H,9,11-12H2,1H3 |
| InChIKey | CDEYHKSVIZLJCG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.81 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |